C31H31F3N4O5 — CID 171482053
N-[7-(hydroxyamino)-7-oxoheptyl]-4-[[5-nitro-1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]methyl]benzamide (PubChem CID 171482053) has the molecular formula C31H31F3N4O5 and a molecular weight of 596.61 g/mol. Its IUPAC name is N-[7-(hydroxyamino)-7-oxoheptyl]-4-[[5-nitro-1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]methyl]benzamide.
| Compound Name | N-[7-(hydroxyamino)-7-oxoheptyl]-4-[[5-nitro-1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 171482053 |
| Molecular Formula | C31H31F3N4O5 |
| Molecular Weight | 596.61 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | N-[7-(hydroxyamino)-7-oxoheptyl]-4-[[5-nitro-1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]methyl]benzamide |
| SMILES | O=C(CCCCCCNC(=O)c1ccc(Cc2cn(Cc3ccc(C(F)(F)F)cc3)c3ccc([N+](=O)[O-])cc23)cc1)NO |
| InChI | InChI=1S/C31H31F3N4O5/c32-31(33,34)25-12-8-22(9-13-25)19-37-20-24(27-18-26(38(42)43)14-15-28(27)37)17-21-6-10-23(11-7-21)30(40)35-16-4-2-1-3-5-29(39)36-41/h6-15,18,20,41H,1-5,16-17,19H2,(H,35,40)(H,36,39) |
| InChIKey | XAELGAKMTYZEFY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.61 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|