C24H28N4O6 — CID 175583205
N-[7-(hydroxyamino)-7-oxoheptyl]-3-methoxy-4-[(5-nitro-1H-indol-3-yl)methyl]benzamide (PubChem CID 175583205) has the molecular formula C24H28N4O6 and a molecular weight of 468.51 g/mol. Its IUPAC name is N-[7-(hydroxyamino)-7-oxoheptyl]-3-methoxy-4-[(5-nitro-1H-indol-3-yl)methyl]benzamide.
| Compound Name | N-[7-(hydroxyamino)-7-oxoheptyl]-3-methoxy-4-[(5-nitro-1H-indol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 175583205 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N-[7-(hydroxyamino)-7-oxoheptyl]-3-methoxy-4-[(5-nitro-1H-indol-3-yl)methyl]benzamide |
| SMILES | COc1cc(C(=O)NCCCCCCC(=O)NO)ccc1Cc1c[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C24H28N4O6/c1-34-22-13-17(24(30)25-11-5-3-2-4-6-23(29)27-31)8-7-16(22)12-18-15-26-21-10-9-19(28(32)33)14-20(18)21/h7-10,13-15,26,31H,2-6,11-12H2,1H3,(H,25,30)(H,27,29) |
| InChIKey | VRDWMRZHZBRHSN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 146.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|