C23H23N5O6 — CID 45269423
N-hydroxy-7,7-bis(5-nitro-1H-indol-3-yl)heptanamide (PubChem CID 45269423) has the molecular formula C23H23N5O6 and a molecular weight of 465.47 g/mol. Its IUPAC name is N-hydroxy-7,7-bis(5-nitro-1H-indol-3-yl)heptanamide.
| Compound Name | N-hydroxy-7,7-bis(5-nitro-1H-indol-3-yl)heptanamide |
|---|---|
| PubChem CID | 45269423 |
| Molecular Formula | C23H23N5O6 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | N-hydroxy-7,7-bis(5-nitro-1H-indol-3-yl)heptanamide |
| SMILES | O=C(CCCCCC(c1c[nH]c2ccc([N+](=O)[O-])cc12)c1c[nH]c2ccc([N+](=O)[O-])cc12)NO |
| InChI | InChI=1S/C23H23N5O6/c29-23(26-30)5-3-1-2-4-16(19-12-24-21-8-6-14(27(31)32)10-17(19)21)20-13-25-22-9-7-15(28(33)34)11-18(20)22/h6-13,16,24-25,30H,1-5H2,(H,26,29) |
| InChIKey | VSVDNXSUROYWOP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 167.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|