C19H19N3O6S — CID 11037144
ethyl 2-[(4-methylphenyl)sulfonylamino]-2-(5-nitro-1H-indol-3-yl)acetate (PubChem CID 11037144) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is ethyl 2-[(4-methylphenyl)sulfonylamino]-2-(5-nitro-1H-indol-3-yl)acetate.
| Compound Name | ethyl 2-[(4-methylphenyl)sulfonylamino]-2-(5-nitro-1H-indol-3-yl)acetate |
|---|---|
| PubChem CID | 11037144 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | ethyl 2-[(4-methylphenyl)sulfonylamino]-2-(5-nitro-1H-indol-3-yl)acetate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1ccc(C)cc1)c1c[nH]c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C19H19N3O6S/c1-3-28-19(23)18(21-29(26,27)14-7-4-12(2)5-8-14)16-11-20-17-9-6-13(22(24)25)10-15(16)17/h4-11,18,20-21H,3H2,1-2H3 |
| InChIKey | TVFNWUBLHVRFDO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|