C32H40N2O10S2 — CID 101063462
butyl 2-[3-[2-butoxy-1-[(4-methylphenyl)sulfonylamino]-2-oxoethyl]-2,5-dihydroxyphenyl]-2-[(4-methylphenyl)sulfonylamino]acetate (PubChem CID 101063462) has the molecular formula C32H40N2O10S2 and a molecular weight of 676.81 g/mol. Its IUPAC name is butyl 2-[3-[2-butoxy-1-[(4-methylphenyl)sulfonylamino]-2-oxoethyl]-2,5-dihydroxyphenyl]-2-[(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | butyl 2-[3-[2-butoxy-1-[(4-methylphenyl)sulfonylamino]-2-oxoethyl]-2,5-dihydroxyphenyl]-2-[(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 101063462 |
| Molecular Formula | C32H40N2O10S2 |
| Molecular Weight | 676.81 g/mol |
| Exact Mass | 676.21 |
| IUPAC Name | butyl 2-[3-[2-butoxy-1-[(4-methylphenyl)sulfonylamino]-2-oxoethyl]-2,5-dihydroxyphenyl]-2-[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | CCCCOC(=O)C(NS(=O)(=O)c1ccc(C)cc1)c1cc(O)cc(C(NS(=O)(=O)c2ccc(C)cc2)C(=O)OCCCC)c1O |
| InChI | InChI=1S/C32H40N2O10S2/c1-5-7-17-43-31(37)28(33-45(39,40)24-13-9-21(3)10-14-24)26-19-23(35)20-27(30(26)36)29(32(38)44-18-8-6-2)34-46(41,42)25-15-11-22(4)12-16-25/h9-16,19-20,28-29,33-36H,5-8,17-18H2,1-4H3 |
| InChIKey | XHGBSEIWFCDYNP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 185.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.81 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|