C46H48N2O10S2 — CID 101063461
butyl 2-[4-[3-[2-butoxy-1-[(4-methylphenyl)sulfonylamino]-2-oxoethyl]-2-hydroxynaphthalen-1-yl]-3-hydroxynaphthalen-2-yl]-2-[(4-methylphenyl)sulfonylamino]acetate (PubChem CID 101063461) has the molecular formula C46H48N2O10S2 and a molecular weight of 853.03 g/mol. Its IUPAC name is butyl 2-[4-[3-[2-butoxy-1-[(4-methylphenyl)sulfonylamino]-2-oxoethyl]-2-hydroxynaphthalen-1-yl]-3-hydroxynaphthalen-2-yl]-2-[(4-methylphenyl)sulfonylamino]acetate.
| Compound Name | butyl 2-[4-[3-[2-butoxy-1-[(4-methylphenyl)sulfonylamino]-2-oxoethyl]-2-hydroxynaphthalen-1-yl]-3-hydroxynaphthalen-2-yl]-2-[(4-methylphenyl)sulfonylamino]acetate |
|---|---|
| PubChem CID | 101063461 |
| Molecular Formula | C46H48N2O10S2 |
| Molecular Weight | 853.03 g/mol |
| Exact Mass | 852.28 |
| IUPAC Name | butyl 2-[4-[3-[2-butoxy-1-[(4-methylphenyl)sulfonylamino]-2-oxoethyl]-2-hydroxynaphthalen-1-yl]-3-hydroxynaphthalen-2-yl]-2-[(4-methylphenyl)sulfonylamino]acetate |
| SMILES | CCCCOC(=O)C(NS(=O)(=O)c1ccc(C)cc1)c1cc2ccccc2c(-c2c(O)c(C(NS(=O)(=O)c3ccc(C)cc3)C(=O)OCCCC)cc3ccccc23)c1O |
| InChI | InChI=1S/C46H48N2O10S2/c1-5-7-25-57-45(51)41(47-59(53,54)33-21-17-29(3)18-22-33)37-27-31-13-9-11-15-35(31)39(43(37)49)40-36-16-12-10-14-32(36)28-38(44(40)50)42(46(52)58-26-8-6-2)48-60(55,56)34-23-19-30(4)20-24-34/h9-24,27-28,41-42,47-50H,5-8,25-26H2,1-4H3 |
| InChIKey | VSWMJWMDNQMACI-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 185.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.03 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|