C12H9F3N2O4 — CID 125474614
methyl (2S)-3,3,3-trifluoro-2-(5-nitro-1H-indol-3-yl)propanoate (PubChem CID 125474614) has the molecular formula C12H9F3N2O4 and a molecular weight of 302.21 g/mol. Its IUPAC name is methyl (2S)-3,3,3-trifluoro-2-(5-nitro-1H-indol-3-yl)propanoate.
| Compound Name | methyl (2S)-3,3,3-trifluoro-2-(5-nitro-1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 125474614 |
| Molecular Formula | C12H9F3N2O4 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.05 |
| IUPAC Name | methyl (2S)-3,3,3-trifluoro-2-(5-nitro-1H-indol-3-yl)propanoate |
| SMILES | COC(=O)[C@H](c1c[nH]c2ccc([N+](=O)[O-])cc12)C(F)(F)F |
| InChI | InChI=1S/C12H9F3N2O4/c1-21-11(18)10(12(13,14)15)8-5-16-9-3-2-6(17(19)20)4-7(8)9/h2-5,10,16H,1H3/t10-/m0/s1 |
| InChIKey | OOBCDSOSYSIJPW-JTQLQIEISA-N |
| XLogP | 2.89 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|