C13H11F3N2O4 — CID 75530455
methyl 3,3,3-trifluoro-2-(2-methyl-5-nitro-1H-indol-3-yl)propanoate (PubChem CID 75530455) has the molecular formula C13H11F3N2O4 and a molecular weight of 316.24 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-(2-methyl-5-nitro-1H-indol-3-yl)propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-(2-methyl-5-nitro-1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 75530455 |
| Molecular Formula | C13H11F3N2O4 |
| Molecular Weight | 316.24 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-(2-methyl-5-nitro-1H-indol-3-yl)propanoate |
| SMILES | COC(=O)C(c1c(C)[nH]c2ccc([N+](=O)[O-])cc12)C(F)(F)F |
| InChI | InChI=1S/C13H11F3N2O4/c1-6-10(11(12(19)22-2)13(14,15)16)8-5-7(18(20)21)3-4-9(8)17-6/h3-5,11,17H,1-2H3 |
| InChIKey | KZPYWMUSVDMDSE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|