C22H16N4O4 — CID 139241936
3-[cyclopenta-1,3-dien-1-yl-(5-nitro-1H-indol-3-yl)methyl]-5-nitro-1H-indole (PubChem CID 139241936) has the molecular formula C22H16N4O4 and a molecular weight of 400.39 g/mol. Its IUPAC name is 3-[cyclopenta-1,3-dien-1-yl-(5-nitro-1H-indol-3-yl)methyl]-5-nitro-1H-indole.
| Compound Name | 3-[cyclopenta-1,3-dien-1-yl-(5-nitro-1H-indol-3-yl)methyl]-5-nitro-1H-indole |
|---|---|
| PubChem CID | 139241936 |
| Molecular Formula | C22H16N4O4 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3-[cyclopenta-1,3-dien-1-yl-(5-nitro-1H-indol-3-yl)methyl]-5-nitro-1H-indole |
| SMILES | O=[N+]([O-])c1ccc2[nH]cc(C(C3=CC=CC3)c3c[nH]c4ccc([N+](=O)[O-])cc34)c2c1 |
| InChI | InChI=1S/C22H16N4O4/c27-25(28)14-5-7-20-16(9-14)18(11-23-20)22(13-3-1-2-4-13)19-12-24-21-8-6-15(26(29)30)10-17(19)21/h1-3,5-12,22-24H,4H2 |
| InChIKey | MXICRIUVQWNPKQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|