C23H20BrN3O2 — CID 166445702
4-[(5-bromo-1H-indol-3-yl)-(4-nitrophenyl)methyl]-N,N-dimethylaniline (PubChem CID 166445702) has the molecular formula C23H20BrN3O2 and a molecular weight of 450.34 g/mol. Its IUPAC name is 4-[(5-bromo-1H-indol-3-yl)-(4-nitrophenyl)methyl]-N,N-dimethylaniline.
| Compound Name | 4-[(5-bromo-1H-indol-3-yl)-(4-nitrophenyl)methyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 166445702 |
| Molecular Formula | C23H20BrN3O2 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 4-[(5-bromo-1H-indol-3-yl)-(4-nitrophenyl)methyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(c2ccc([N+](=O)[O-])cc2)c2c[nH]c3ccc(Br)cc23)cc1 |
| InChI | InChI=1S/C23H20BrN3O2/c1-26(2)18-8-3-15(4-9-18)23(16-5-10-19(11-6-16)27(28)29)21-14-25-22-12-7-17(24)13-20(21)22/h3-14,23,25H,1-2H3 |
| InChIKey | SKWDIPCNRVWOQA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|