C23H21ClN2 — CID 102231510
4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline (PubChem CID 102231510) has the molecular formula C23H21ClN2 and a molecular weight of 360.89 g/mol. Its IUPAC name is 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline.
| Compound Name | 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 102231510 |
| Molecular Formula | C23H21ClN2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(c2ccccc2)c2c[nH]c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C23H21ClN2/c1-26(2)19-11-8-17(9-12-19)23(16-6-4-3-5-7-16)21-15-25-22-13-10-18(24)14-20(21)22/h3-15,23,25H,1-2H3 |
| InChIKey | OYGROXNCBUXTCV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |