About 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline
4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline (PubChem CID 102231510) has the molecular formula C23H21ClN2
and a molecular weight of 360.89 g/mol. Its IUPAC name is 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline |
| PubChem CID | 102231510 |
| Molecular Formula | C23H21ClN2 |
| Molecular Weight | 360.89 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(c2ccccc2)c2c[nH]c3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C23H21ClN2/c1-26(2)19-11-8-17(9-12-19)23(16-6-4-3-5-7-16)21-15-25-22-13-10-18(24)14-20(21)22/h3-15,23,25H,1-2H3 |
| InChIKey | OYGROXNCBUXTCV-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.89 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline?
The IUPAC name of 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline (CID 102231510) is 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline.
What is the SMILES notation for 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline?
The canonical SMILES for 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline is CN(C)c1ccc(C(c2ccccc2)c2c[nH]c3ccc(Cl)cc23)cc1.
What is the InChIKey of 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline?
The InChIKey is OYGROXNCBUXTCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21ClN2/c1-26(2)19-11-8-17(9-12-19)23(16-6-4-3-5-7-16)21-15-25-22-13-10-18(24)14-20(21)22/h3-15,23,25H,1-2H3.
What are the key properties of 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline?
4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline has a molecular weight of 360.89 g/mol, XLogP of 6.07, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(5-chloro-1H-indol-3-yl)-phenylmethyl]-N,N-dimethylaniline is sourced from PubChem (CID 102231510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).