C21H18N- — CID 135014983
3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-5-methyl-1H-indole (PubChem CID 135014983) has the molecular formula C21H18N- and a molecular weight of 284.38 g/mol. Its IUPAC name is 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-5-methyl-1H-indole.
| Compound Name | 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-5-methyl-1H-indole |
|---|---|
| PubChem CID | 135014983 |
| Molecular Formula | C21H18N- |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3-[cyclopenta-1,4-dien-1-yl(phenyl)methyl]-5-methyl-1H-indole |
| SMILES | Cc1ccc2[nH]cc(C(c3ccccc3)c3cc[cH-]c3)c2c1 |
| InChI | InChI=1S/C21H18N/c1-15-11-12-20-18(13-15)19(14-22-20)21(17-9-5-6-10-17)16-7-3-2-4-8-16/h2-14,21-22H,1H3/q-1 |
| InChIKey | OOSNZDRBFLAYCC-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|