C25H25NO — CID 3705119
3-[(4-methoxyphenyl)-(2,4,6-trimethylphenyl)methyl]-1H-indole (PubChem CID 3705119) has the molecular formula C25H25NO and a molecular weight of 355.48 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)-(2,4,6-trimethylphenyl)methyl]-1H-indole.
| Compound Name | 3-[(4-methoxyphenyl)-(2,4,6-trimethylphenyl)methyl]-1H-indole |
|---|---|
| PubChem CID | 3705119 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 3-[(4-methoxyphenyl)-(2,4,6-trimethylphenyl)methyl]-1H-indole |
| SMILES | COc1ccc(C(c2c(C)cc(C)cc2C)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H25NO/c1-16-13-17(2)24(18(3)14-16)25(19-9-11-20(27-4)12-10-19)22-15-26-23-8-6-5-7-21(22)23/h5-15,25-26H,1-4H3 |
| InChIKey | IGAAQTJMNKRMEE-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |