C35H31N3O — CID 25008232
3-[2,4-bis(1H-indol-3-yl)-4-(4-methoxyphenyl)butan-2-yl]-1H-indole (PubChem CID 25008232) has the molecular formula C35H31N3O and a molecular weight of 509.65 g/mol. Its IUPAC name is 3-[2,4-bis(1H-indol-3-yl)-4-(4-methoxyphenyl)butan-2-yl]-1H-indole.
| Compound Name | 3-[2,4-bis(1H-indol-3-yl)-4-(4-methoxyphenyl)butan-2-yl]-1H-indole |
|---|---|
| PubChem CID | 25008232 |
| Molecular Formula | C35H31N3O |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | 3-[2,4-bis(1H-indol-3-yl)-4-(4-methoxyphenyl)butan-2-yl]-1H-indole |
| SMILES | COc1ccc(C(CC(C)(c2c[nH]c3ccccc23)c2c[nH]c3ccccc23)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C35H31N3O/c1-35(30-21-37-33-13-7-4-10-26(30)33,31-22-38-34-14-8-5-11-27(31)34)19-28(23-15-17-24(39-2)18-16-23)29-20-36-32-12-6-3-9-25(29)32/h3-18,20-22,28,36-38H,19H2,1-2H3 |
| InChIKey | PEOCBNOAYSPEGG-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 56.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |