C28H23NO2 — CID 126715490
3-(1H-indol-3-yl)-3-(4-methoxyphenyl)-1-naphthalen-2-ylpropan-1-one (PubChem CID 126715490) has the molecular formula C28H23NO2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-3-(4-methoxyphenyl)-1-naphthalen-2-ylpropan-1-one.
| Compound Name | 3-(1H-indol-3-yl)-3-(4-methoxyphenyl)-1-naphthalen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 126715490 |
| Molecular Formula | C28H23NO2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 3-(1H-indol-3-yl)-3-(4-methoxyphenyl)-1-naphthalen-2-ylpropan-1-one |
| SMILES | COc1ccc(C(CC(=O)c2ccc3ccccc3c2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H23NO2/c1-31-23-14-12-20(13-15-23)25(26-18-29-27-9-5-4-8-24(26)27)17-28(30)22-11-10-19-6-2-3-7-21(19)16-22/h2-16,18,25,29H,17H2,1H3 |
| InChIKey | DKCDGRFZWGKZBR-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |