C20H22N2 — CID 142943492
3,5-dimethyl-1H-indole (PubChem CID 142943492) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3,5-dimethyl-1H-indole.
| Compound Name | 3,5-dimethyl-1H-indole |
|---|---|
| PubChem CID | 142943492 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 3,5-dimethyl-1H-indole |
| SMILES | Cc1ccc2[nH]cc(C)c2c1.Cc1ccc2[nH]cc(C)c2c1 |
| InChI | InChI=1S/2C10H11N/c2*1-7-3-4-10-9(5-7)8(2)6-11-10/h2*3-6,11H,1-2H3 |
| InChIKey | ZSZHEHHBIFICSD-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |