About CID 170793017
CID 170793017 (PubChem CID 170793017) has the molecular formula C9H8GaN
and a molecular weight of 199.89 g/mol.
Molecular Properties
| Compound Name | CID 170793017 |
| PubChem CID | 170793017 |
| Molecular Formula | C9H8GaN |
| Molecular Weight | 199.89 g/mol |
| Exact Mass | 198.99 |
| IUPAC Name | — |
| SMILES | Cc1ccc2[nH]cc([Ga])c2c1 |
| InChI | InChI=1S/C9H8N.Ga/c1-7-2-3-9-8(6-7)4-5-10-9;/h2-3,5-6,10H,1H3; |
| InChIKey | YFPDBNJURXPUHI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.89 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 170793017 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170793017?
The IUPAC name of CID 170793017 (CID 170793017) is not available.
What is the SMILES notation for CID 170793017?
The canonical SMILES for CID 170793017 is Cc1ccc2[nH]cc([Ga])c2c1.
What is the InChIKey of CID 170793017?
The InChIKey is YFPDBNJURXPUHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N.Ga/c1-7-2-3-9-8(6-7)4-5-10-9;/h2-3,5-6,10H,1H3;.
What are the key properties of CID 170793017?
CID 170793017 has a molecular weight of 199.89 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170793017 is sourced from PubChem (CID 170793017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).