About 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile
4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile (PubChem CID 142472360) has the molecular formula C17H16N2S
and a molecular weight of 280.40 g/mol. Its IUPAC name is 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile.
Molecular Properties
| Compound Name | 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile |
| PubChem CID | 142472360 |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.40 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile |
| SMILES | Cc1c[nH]c2ccc(C#N)cc12.Cc1ccc(S)cc1 |
| InChI | InChI=1S/C10H8N2.C7H8S/c1-7-6-12-10-3-2-8(5-11)4-9(7)10;1-6-2-4-7(8)5-3-6/h2-4,6,12H,1H3;2-5,8H,1H3 |
| InChIKey | WLPWKLYSBFECTI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile?
The IUPAC name of 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile (CID 142472360) is 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile.
What is the SMILES notation for 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile?
The canonical SMILES for 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile is Cc1c[nH]c2ccc(C#N)cc12.Cc1ccc(S)cc1.
What is the InChIKey of 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile?
The InChIKey is WLPWKLYSBFECTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C7H8S/c1-7-6-12-10-3-2-8(5-11)4-9(7)10;1-6-2-4-7(8)5-3-6/h2-4,6,12H,1H3;2-5,8H,1H3.
What are the key properties of 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile?
4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile has a molecular weight of 280.40 g/mol, XLogP of 4.63, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylbenzenethiol;3-methyl-1H-indole-5-carbonitrile is sourced from PubChem (CID 142472360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).