About (5-cyano-1H-indol-3-yl) 3-methylbutanoate
(5-cyano-1H-indol-3-yl) 3-methylbutanoate (PubChem CID 174468857) has the molecular formula C14H14N2O2
and a molecular weight of 242.28 g/mol. Its IUPAC name is (5-cyano-1H-indol-3-yl) 3-methylbutanoate.
Molecular Properties
| Compound Name | (5-cyano-1H-indol-3-yl) 3-methylbutanoate |
| PubChem CID | 174468857 |
| Molecular Formula | C14H14N2O2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (5-cyano-1H-indol-3-yl) 3-methylbutanoate |
| SMILES | CC(C)CC(=O)Oc1c[nH]c2ccc(C#N)cc12 |
| InChI | InChI=1S/C14H14N2O2/c1-9(2)5-14(17)18-13-8-16-12-4-3-10(7-15)6-11(12)13/h3-4,6,8-9,16H,5H2,1-2H3 |
| InChIKey | RKAZVXPIIYVOJS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-cyano-1H-indol-3-yl) 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyano-1H-indol-3-yl) 3-methylbutanoate?
The IUPAC name of (5-cyano-1H-indol-3-yl) 3-methylbutanoate (CID 174468857) is (5-cyano-1H-indol-3-yl) 3-methylbutanoate.
What is the SMILES notation for (5-cyano-1H-indol-3-yl) 3-methylbutanoate?
The canonical SMILES for (5-cyano-1H-indol-3-yl) 3-methylbutanoate is CC(C)CC(=O)Oc1c[nH]c2ccc(C#N)cc12.
What is the InChIKey of (5-cyano-1H-indol-3-yl) 3-methylbutanoate?
The InChIKey is RKAZVXPIIYVOJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2O2/c1-9(2)5-14(17)18-13-8-16-12-4-3-10(7-15)6-11(12)13/h3-4,6,8-9,16H,5H2,1-2H3.
What are the key properties of (5-cyano-1H-indol-3-yl) 3-methylbutanoate?
(5-cyano-1H-indol-3-yl) 3-methylbutanoate has a molecular weight of 242.28 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyano-1H-indol-3-yl) 3-methylbutanoate is sourced from PubChem (CID 174468857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).