C15H16N2O — CID 114015915
3-(2,2-dimethylbutanoyl)-1H-indole-5-carbonitrile (PubChem CID 114015915) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-(2,2-dimethylbutanoyl)-1H-indole-5-carbonitrile.
| Compound Name | 3-(2,2-dimethylbutanoyl)-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 114015915 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 3-(2,2-dimethylbutanoyl)-1H-indole-5-carbonitrile |
| SMILES | CCC(C)(C)C(=O)c1c[nH]c2ccc(C#N)cc12 |
| InChI | InChI=1S/C15H16N2O/c1-4-15(2,3)14(18)12-9-17-13-6-5-10(8-16)7-11(12)13/h5-7,9,17H,4H2,1-3H3 |
| InChIKey | LGGHSYXPXTWUPS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |