C12H10N2O4 — CID 170825364
3-(5-cyano-1H-indol-3-yl)-2,3-dihydroxypropanoic acid (PubChem CID 170825364) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is 3-(5-cyano-1H-indol-3-yl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(5-cyano-1H-indol-3-yl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170825364 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 3-(5-cyano-1H-indol-3-yl)-2,3-dihydroxypropanoic acid |
| SMILES | N#Cc1ccc2[nH]cc(C(O)C(O)C(=O)O)c2c1 |
| InChI | InChI=1S/C12H10N2O4/c13-4-6-1-2-9-7(3-6)8(5-14-9)10(15)11(16)12(17)18/h1-3,5,10-11,14-16H,(H,17,18) |
| InChIKey | WGDJBENQKVGQAS-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |