C26H18N2 — CID 134830615
3-(1,5-diphenylpent-1-en-4-yn-3-yl)-1H-indole-5-carbonitrile (PubChem CID 134830615) has the molecular formula C26H18N2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-(1,5-diphenylpent-1-en-4-yn-3-yl)-1H-indole-5-carbonitrile.
| Compound Name | 3-(1,5-diphenylpent-1-en-4-yn-3-yl)-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 134830615 |
| Molecular Formula | C26H18N2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 3-(1,5-diphenylpent-1-en-4-yn-3-yl)-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(C(C#Cc3ccccc3)C=Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C26H18N2/c27-18-22-13-16-26-24(17-22)25(19-28-26)23(14-11-20-7-3-1-4-8-20)15-12-21-9-5-2-6-10-21/h1-11,13-14,16-17,19,23,28H |
| InChIKey | KTQVPSXQMOHDFS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|