C12H11N5O2 — CID 170827417
3-(3-azido-1,2-dihydroxypropyl)-1H-indole-5-carbonitrile (PubChem CID 170827417) has the molecular formula C12H11N5O2 and a molecular weight of 257.25 g/mol. Its IUPAC name is 3-(3-azido-1,2-dihydroxypropyl)-1H-indole-5-carbonitrile.
| Compound Name | 3-(3-azido-1,2-dihydroxypropyl)-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 170827417 |
| Molecular Formula | C12H11N5O2 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 3-(3-azido-1,2-dihydroxypropyl)-1H-indole-5-carbonitrile |
| SMILES | N#Cc1ccc2[nH]cc(C(O)C(O)CN=[N+]=[N-])c2c1 |
| InChI | InChI=1S/C12H11N5O2/c13-4-7-1-2-10-8(3-7)9(5-15-10)12(19)11(18)6-16-17-14/h1-3,5,11-12,15,18-19H,6H2 |
| InChIKey | MXABHEZDLJFTSD-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 128.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|