C11H9F3N4O2 — CID 170826929
3-(3-azido-1,2-dihydroxypropyl)-5-(trifluoromethyl)benzonitrile (PubChem CID 170826929) has the molecular formula C11H9F3N4O2 and a molecular weight of 286.21 g/mol. Its IUPAC name is 3-(3-azido-1,2-dihydroxypropyl)-5-(trifluoromethyl)benzonitrile.
| Compound Name | 3-(3-azido-1,2-dihydroxypropyl)-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 170826929 |
| Molecular Formula | C11H9F3N4O2 |
| Molecular Weight | 286.21 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3-(3-azido-1,2-dihydroxypropyl)-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(O)C(O)CN=[N+]=[N-])cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9F3N4O2/c12-11(13,14)8-2-6(4-15)1-7(3-8)10(20)9(19)5-17-18-16/h1-3,9-10,19-20H,5H2 |
| InChIKey | HPQVRHGJMPATLC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|