C11H12F3N3O3 — CID 170826888
3-azido-1-[2-(hydroxymethyl)-4-(trifluoromethyl)phenyl]propane-1,2-diol (PubChem CID 170826888) has the molecular formula C11H12F3N3O3 and a molecular weight of 291.23 g/mol. Its IUPAC name is 3-azido-1-[2-(hydroxymethyl)-4-(trifluoromethyl)phenyl]propane-1,2-diol.
| Compound Name | 3-azido-1-[2-(hydroxymethyl)-4-(trifluoromethyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 170826888 |
| Molecular Formula | C11H12F3N3O3 |
| Molecular Weight | 291.23 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-azido-1-[2-(hydroxymethyl)-4-(trifluoromethyl)phenyl]propane-1,2-diol |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1ccc(C(F)(F)F)cc1CO |
| InChI | InChI=1S/C11H12F3N3O3/c12-11(13,14)7-1-2-8(6(3-7)5-18)10(20)9(19)4-16-17-15/h1-3,9-10,18-20H,4-5H2 |
| InChIKey | PYMNTWNKILKKFB-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 109.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|