C14H15N3O2 — CID 170826749
3-azido-1-(4-methylnaphthalen-1-yl)propane-1,2-diol (PubChem CID 170826749) has the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. Its IUPAC name is 3-azido-1-(4-methylnaphthalen-1-yl)propane-1,2-diol.
| Compound Name | 3-azido-1-(4-methylnaphthalen-1-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 170826749 |
| Molecular Formula | C14H15N3O2 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-azido-1-(4-methylnaphthalen-1-yl)propane-1,2-diol |
| SMILES | Cc1ccc(C(O)C(O)CN=[N+]=[N-])c2ccccc12 |
| InChI | InChI=1S/C14H15N3O2/c1-9-6-7-12(11-5-3-2-4-10(9)11)14(19)13(18)8-16-17-15/h2-7,13-14,18-19H,8H2,1H3 |
| InChIKey | VWMYJWFSIVRPIJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 89.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|