C9H13N5O2 — CID 170825697
1-(6-amino-3-methyl-2-pyridinyl)-3-azidopropane-1,2-diol (PubChem CID 170825697) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 1-(6-amino-3-methyl-2-pyridinyl)-3-azidopropane-1,2-diol.
| Compound Name | 1-(6-amino-3-methyl-2-pyridinyl)-3-azidopropane-1,2-diol |
|---|---|
| PubChem CID | 170825697 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 1-(6-amino-3-methyl-2-pyridinyl)-3-azidopropane-1,2-diol |
| SMILES | Cc1ccc(N)nc1C(O)C(O)CN=[N+]=[N-] |
| InChI | InChI=1S/C9H13N5O2/c1-5-2-3-7(10)13-8(5)9(16)6(15)4-12-14-11/h2-3,6,9,15-16H,4H2,1H3,(H2,10,13) |
| InChIKey | PVVQEAJPPPUXBW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|