C13H14N4O2 — CID 170826793
3-azido-1-(2-methylquinolin-6-yl)propane-1,2-diol (PubChem CID 170826793) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is 3-azido-1-(2-methylquinolin-6-yl)propane-1,2-diol.
| Compound Name | 3-azido-1-(2-methylquinolin-6-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 170826793 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 3-azido-1-(2-methylquinolin-6-yl)propane-1,2-diol |
| SMILES | Cc1ccc2cc(C(O)C(O)CN=[N+]=[N-])ccc2n1 |
| InChI | InChI=1S/C13H14N4O2/c1-8-2-3-9-6-10(4-5-11(9)16-8)13(19)12(18)7-15-17-14/h2-6,12-13,18-19H,7H2,1H3 |
| InChIKey | VFYOLVTUDFHYNV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 102.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|