C10H11N5O2 — CID 170826176
3-azido-1-(1H-indazol-5-yl)propane-1,2-diol (PubChem CID 170826176) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-azido-1-(1H-indazol-5-yl)propane-1,2-diol.
| Compound Name | 3-azido-1-(1H-indazol-5-yl)propane-1,2-diol |
|---|---|
| PubChem CID | 170826176 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-azido-1-(1H-indazol-5-yl)propane-1,2-diol |
| SMILES | [N-]=[N+]=NCC(O)C(O)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C10H11N5O2/c11-15-13-5-9(16)10(17)6-1-2-8-7(3-6)4-12-14-8/h1-4,9-10,16-17H,5H2,(H,12,14) |
| InChIKey | WPSZNPKUNCMMIB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 117.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|