ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate

C12H14N2O4 — CID 171866255

IUPACethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate
SMILESCCOC(=O)C(O)C(O)c1ccc2[nH]ncc2c1
InChIInChI=1S/C12H14N2O4/c1-2-18-12(17)11(16)10(15)7-3-4-9-8(5-7)6-13-14-9/h3-6,10-11,15-16H,2H2,1H3,(H,13,14)
InChIKeyNHEKYPOICFQMQY-UHFFFAOYSA-N
MW250.25 g/mol
LogP0.52
Rot. Bonds4

About ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate

ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate (PubChem CID 171866255) has the molecular formula C12H14N2O4 and a molecular weight of 250.25 g/mol. Its IUPAC name is ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate.

Molecular Properties

Compound Nameethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate
PubChem CID171866255
Molecular FormulaC12H14N2O4
Molecular Weight250.25 g/mol
Exact Mass250.10
IUPAC Nameethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate
SMILESCCOC(=O)C(O)C(O)c1ccc2[nH]ncc2c1
InChIInChI=1S/C12H14N2O4/c1-2-18-12(17)11(16)10(15)7-3-4-9-8(5-7)6-13-14-9/h3-6,10-11,15-16H,2H2,1H3,(H,13,14)
InChIKeyNHEKYPOICFQMQY-UHFFFAOYSA-N
XLogP0.52
TPSA95.44 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.25
LogP ≤ 50.52
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate?
The IUPAC name of ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate (CID 171866255) is ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate.
What is the SMILES notation for ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate?
The canonical SMILES for ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate is CCOC(=O)C(O)C(O)c1ccc2[nH]ncc2c1.
What is the InChIKey of ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate?
The InChIKey is NHEKYPOICFQMQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O4/c1-2-18-12(17)11(16)10(15)7-3-4-9-8(5-7)6-13-14-9/h3-6,10-11,15-16H,2H2,1H3,(H,13,14).
What are the key properties of ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate?
ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate has a molecular weight of 250.25 g/mol, XLogP of 0.52, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,3-dihydroxy-3-(1H-indazol-5-yl)propanoate is sourced from PubChem (CID 171866255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).