C12H14N2O4S — CID 171866300
ethyl 3-(2-amino-1,3-benzothiazol-5-yl)-2,3-dihydroxypropanoate (PubChem CID 171866300) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is ethyl 3-(2-amino-1,3-benzothiazol-5-yl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(2-amino-1,3-benzothiazol-5-yl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171866300 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | ethyl 3-(2-amino-1,3-benzothiazol-5-yl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1ccc2sc(N)nc2c1 |
| InChI | InChI=1S/C12H14N2O4S/c1-2-18-11(17)10(16)9(15)6-3-4-8-7(5-6)14-12(13)19-8/h3-5,9-10,15-16H,2H2,1H3,(H2,13,14) |
| InChIKey | XSQNKCIAGXUQGP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |