C14H16N2O5 — CID 171898147
ethyl 3,4-dihydroxy-4-(1-oxo-2H-phthalazin-6-yl)butanoate (PubChem CID 171898147) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(1-oxo-2H-phthalazin-6-yl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(1-oxo-2H-phthalazin-6-yl)butanoate |
|---|---|
| PubChem CID | 171898147 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(1-oxo-2H-phthalazin-6-yl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc2c(=O)[nH]ncc2c1 |
| InChI | InChI=1S/C14H16N2O5/c1-2-21-12(18)6-11(17)13(19)8-3-4-10-9(5-8)7-15-16-14(10)20/h3-5,7,11,13,17,19H,2,6H2,1H3,(H,16,20) |
| InChIKey | VQBWALSTUYFFMW-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |