C18H19NO4 — CID 171898377
ethyl 4-(9H-carbazol-2-yl)-3,4-dihydroxybutanoate (PubChem CID 171898377) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is ethyl 4-(9H-carbazol-2-yl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(9H-carbazol-2-yl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171898377 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | ethyl 4-(9H-carbazol-2-yl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C18H19NO4/c1-2-23-17(21)10-16(20)18(22)11-7-8-13-12-5-3-4-6-14(12)19-15(13)9-11/h3-9,16,18-20,22H,2,10H2,1H3 |
| InChIKey | UWLVVIWZSRUICF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |