C16H16N2O3 — CID 171900169
4-(9H-carbazol-2-yl)-3,4-dihydroxybutanamide (PubChem CID 171900169) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-(9H-carbazol-2-yl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(9H-carbazol-2-yl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171900169 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-(9H-carbazol-2-yl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C16H16N2O3/c17-15(20)8-14(19)16(21)9-5-6-11-10-3-1-2-4-12(10)18-13(11)7-9/h1-7,14,16,18-19,21H,8H2,(H2,17,20) |
| InChIKey | KXWYOTIGQQPHOM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |