C18H17NO3 — CID 171900199
4-anthracen-9-yl-3,4-dihydroxybutanamide (PubChem CID 171900199) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-anthracen-9-yl-3,4-dihydroxybutanamide.
| Compound Name | 4-anthracen-9-yl-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171900199 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 4-anthracen-9-yl-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C18H17NO3/c19-16(21)10-15(20)18(22)17-13-7-3-1-5-11(13)9-12-6-2-4-8-14(12)17/h1-9,15,18,20,22H,10H2,(H2,19,21) |
| InChIKey | ZSSXREFRXPKQQP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|