C12H13NO3S — CID 171899320
4-(1-benzothiophen-3-yl)-3,4-dihydroxybutanamide (PubChem CID 171899320) has the molecular formula C12H13NO3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 4-(1-benzothiophen-3-yl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(1-benzothiophen-3-yl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171899320 |
| Molecular Formula | C12H13NO3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 4-(1-benzothiophen-3-yl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1csc2ccccc12 |
| InChI | InChI=1S/C12H13NO3S/c13-11(15)5-9(14)12(16)8-6-17-10-4-2-1-3-7(8)10/h1-4,6,9,12,14,16H,5H2,(H2,13,15) |
| InChIKey | CCMOMXXAACUMME-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |