methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate

C12H12O3S — CID 102175267

IUPACmethyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate
SMILESCOC(=O)C[C@H](O)c1csc2ccccc12
InChIInChI=1S/C12H12O3S/c1-15-12(14)6-10(13)9-7-16-11-5-3-2-4-8(9)11/h2-5,7,10,13H,6H2,1H3/t10-/m0/s1
InChIKeySLQUREWZSYNRBY-JTQLQIEISA-N
MW236.29 g/mol
LogP2.50
Rot. Bonds3

About methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate

methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate (PubChem CID 102175267) has the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. Its IUPAC name is methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate.

Molecular Properties

Compound Namemethyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate
PubChem CID102175267
Molecular FormulaC12H12O3S
Molecular Weight236.29 g/mol
Exact Mass236.05
IUPAC Namemethyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate
SMILESCOC(=O)C[C@H](O)c1csc2ccccc12
InChIInChI=1S/C12H12O3S/c1-15-12(14)6-10(13)9-7-16-11-5-3-2-4-8(9)11/h2-5,7,10,13H,6H2,1H3/t10-/m0/s1
InChIKeySLQUREWZSYNRBY-JTQLQIEISA-N
XLogP2.50
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.29
LogP ≤ 52.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate?
The IUPAC name of methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate (CID 102175267) is methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate.
What is the SMILES notation for methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate?
The canonical SMILES for methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate is COC(=O)C[C@H](O)c1csc2ccccc12.
What is the InChIKey of methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate?
The InChIKey is SLQUREWZSYNRBY-JTQLQIEISA-N. The full InChI is InChI=1S/C12H12O3S/c1-15-12(14)6-10(13)9-7-16-11-5-3-2-4-8(9)11/h2-5,7,10,13H,6H2,1H3/t10-/m0/s1.
What are the key properties of methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate?
methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate has a molecular weight of 236.29 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate is sourced from PubChem (CID 102175267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).