C12H12O3S — CID 102175267
methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate (PubChem CID 102175267) has the molecular formula C12H12O3S and a molecular weight of 236.29 g/mol. Its IUPAC name is methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate.
| Compound Name | methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 102175267 |
| Molecular Formula | C12H12O3S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | methyl (3S)-3-(1-benzothiophen-3-yl)-3-hydroxypropanoate |
| SMILES | COC(=O)C[C@H](O)c1csc2ccccc12 |
| InChI | InChI=1S/C12H12O3S/c1-15-12(14)6-10(13)9-7-16-11-5-3-2-4-8(9)11/h2-5,7,10,13H,6H2,1H3/t10-/m0/s1 |
| InChIKey | SLQUREWZSYNRBY-JTQLQIEISA-N |
| XLogP | 2.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |