C16H15NO4 — CID 171865046
methyl 3-(9H-carbazol-3-yl)-2,3-dihydroxypropanoate (PubChem CID 171865046) has the molecular formula C16H15NO4 and a molecular weight of 285.30 g/mol. Its IUPAC name is methyl 3-(9H-carbazol-3-yl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(9H-carbazol-3-yl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171865046 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | methyl 3-(9H-carbazol-3-yl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc2[nH]c3ccccc3c2c1 |
| InChI | InChI=1S/C16H15NO4/c1-21-16(20)15(19)14(18)9-6-7-13-11(8-9)10-4-2-3-5-12(10)17-13/h2-8,14-15,17-19H,1H3 |
| InChIKey | JAOMGPXHBTXSAE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |