C13H13NO6 — CID 171864883
3-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-1H-indole-2-carboxylic acid (PubChem CID 171864883) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is 3-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-1H-indole-2-carboxylic acid.
| Compound Name | 3-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 171864883 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-(1,2-dihydroxy-3-methoxy-3-oxopropyl)-1H-indole-2-carboxylic acid |
| SMILES | COC(=O)C(O)C(O)c1c(C(=O)O)[nH]c2ccccc12 |
| InChI | InChI=1S/C13H13NO6/c1-20-13(19)11(16)10(15)8-6-4-2-3-5-7(6)14-9(8)12(17)18/h2-5,10-11,14-16H,1H3,(H,17,18) |
| InChIKey | QMTNKAPNAPKKOU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|