C13H14BrNO4 — CID 171892838
3-(4-bromo-1,2-dihydroxybutyl)-1H-indole-2-carboxylic acid (PubChem CID 171892838) has the molecular formula C13H14BrNO4 and a molecular weight of 328.16 g/mol. Its IUPAC name is 3-(4-bromo-1,2-dihydroxybutyl)-1H-indole-2-carboxylic acid.
| Compound Name | 3-(4-bromo-1,2-dihydroxybutyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 171892838 |
| Molecular Formula | C13H14BrNO4 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 3-(4-bromo-1,2-dihydroxybutyl)-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2ccccc2c1C(O)C(O)CCBr |
| InChI | InChI=1S/C13H14BrNO4/c14-6-5-9(16)12(17)10-7-3-1-2-4-8(7)15-11(10)13(18)19/h1-4,9,12,15-17H,5-6H2,(H,18,19) |
| InChIKey | KCPNCUOLDVWCKF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|