C12H11NO6 — CID 170824785
3-(2-carboxy-1,2-dihydroxyethyl)-1H-indole-2-carboxylic acid (PubChem CID 170824785) has the molecular formula C12H11NO6 and a molecular weight of 265.22 g/mol. Its IUPAC name is 3-(2-carboxy-1,2-dihydroxyethyl)-1H-indole-2-carboxylic acid.
| Compound Name | 3-(2-carboxy-1,2-dihydroxyethyl)-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 170824785 |
| Molecular Formula | C12H11NO6 |
| Molecular Weight | 265.22 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 3-(2-carboxy-1,2-dihydroxyethyl)-1H-indole-2-carboxylic acid |
| SMILES | O=C(O)c1[nH]c2ccccc2c1C(O)C(O)C(=O)O |
| InChI | InChI=1S/C12H11NO6/c14-9(10(15)12(18)19)7-5-3-1-2-4-6(5)13-8(7)11(16)17/h1-4,9-10,13-15H,(H,16,17)(H,18,19) |
| InChIKey | NNBMBNMFTXXFDD-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.22 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|