C27H22N2O5 — CID 141443391
3-[(2-methoxycarbonyl-1H-indol-3-yl)-(4-methoxyphenyl)methyl]-1H-indole-2-carboxylic acid (PubChem CID 141443391) has the molecular formula C27H22N2O5 and a molecular weight of 454.48 g/mol. Its IUPAC name is 3-[(2-methoxycarbonyl-1H-indol-3-yl)-(4-methoxyphenyl)methyl]-1H-indole-2-carboxylic acid.
| Compound Name | 3-[(2-methoxycarbonyl-1H-indol-3-yl)-(4-methoxyphenyl)methyl]-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 141443391 |
| Molecular Formula | C27H22N2O5 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 3-[(2-methoxycarbonyl-1H-indol-3-yl)-(4-methoxyphenyl)methyl]-1H-indole-2-carboxylic acid |
| SMILES | COC(=O)c1[nH]c2ccccc2c1C(c1ccc(OC)cc1)c1c(C(=O)O)[nH]c2ccccc12 |
| InChI | InChI=1S/C27H22N2O5/c1-33-16-13-11-15(12-14-16)21(22-17-7-3-5-9-19(17)28-24(22)26(30)31)23-18-8-4-6-10-20(18)29-25(23)27(32)34-2/h3-14,21,28-29H,1-2H3,(H,30,31) |
| InChIKey | DFDTYZJATYOMNB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|