C21H23NO7 — CID 44597418
methyl 3-[hydroxy-(3,4,5-trimethoxyphenyl)methyl]-5-methoxy-1H-indole-2-carboxylate (PubChem CID 44597418) has the molecular formula C21H23NO7 and a molecular weight of 401.42 g/mol. Its IUPAC name is methyl 3-[hydroxy-(3,4,5-trimethoxyphenyl)methyl]-5-methoxy-1H-indole-2-carboxylate.
| Compound Name | methyl 3-[hydroxy-(3,4,5-trimethoxyphenyl)methyl]-5-methoxy-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 44597418 |
| Molecular Formula | C21H23NO7 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | methyl 3-[hydroxy-(3,4,5-trimethoxyphenyl)methyl]-5-methoxy-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2ccc(OC)cc2c1C(O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H23NO7/c1-25-12-6-7-14-13(10-12)17(18(22-14)21(24)29-5)19(23)11-8-15(26-2)20(28-4)16(9-11)27-3/h6-10,19,22-23H,1-5H3 |
| InChIKey | WDQZXUMJDZPTSX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|