C13H15NO4 — CID 100944788
ethyl 3-(1,2-dihydroxyethyl)-1H-indole-2-carboxylate (PubChem CID 100944788) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is ethyl 3-(1,2-dihydroxyethyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-(1,2-dihydroxyethyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 100944788 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | ethyl 3-(1,2-dihydroxyethyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1C(O)CO |
| InChI | InChI=1S/C13H15NO4/c1-2-18-13(17)12-11(10(16)7-15)8-5-3-4-6-9(8)14-12/h3-6,10,14-16H,2,7H2,1H3 |
| InChIKey | MDAMIMOXTBKHAV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|