C15H11N3O2 — CID 10587751
ethyl 3-(2,2-dicyanoethenyl)-1H-indole-2-carboxylate (PubChem CID 10587751) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is ethyl 3-(2,2-dicyanoethenyl)-1H-indole-2-carboxylate.
| Compound Name | ethyl 3-(2,2-dicyanoethenyl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 10587751 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | ethyl 3-(2,2-dicyanoethenyl)-1H-indole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2ccccc2c1C=C(C#N)C#N |
| InChI | InChI=1S/C15H11N3O2/c1-2-20-15(19)14-12(7-10(8-16)9-17)11-5-3-4-6-13(11)18-14/h3-7,18H,2H2,1H3 |
| InChIKey | LCIVLXIUBWYGJL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|