C10H10F2O4 — CID 171863651
methyl 3-(3,4-difluorophenyl)-2,3-dihydroxypropanoate (PubChem CID 171863651) has the molecular formula C10H10F2O4 and a molecular weight of 232.18 g/mol. Its IUPAC name is methyl 3-(3,4-difluorophenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(3,4-difluorophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171863651 |
| Molecular Formula | C10H10F2O4 |
| Molecular Weight | 232.18 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | methyl 3-(3,4-difluorophenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H10F2O4/c1-16-10(15)9(14)8(13)5-2-3-6(11)7(12)4-5/h2-4,8-9,13-14H,1H3 |
| InChIKey | MMTTXLKMKCYKQQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |