C10H9F3O4 — CID 171863882
methyl 2,3-dihydroxy-3-(2,3,6-trifluorophenyl)propanoate (PubChem CID 171863882) has the molecular formula C10H9F3O4 and a molecular weight of 250.17 g/mol. Its IUPAC name is methyl 2,3-dihydroxy-3-(2,3,6-trifluorophenyl)propanoate.
| Compound Name | methyl 2,3-dihydroxy-3-(2,3,6-trifluorophenyl)propanoate |
|---|---|
| PubChem CID | 171863882 |
| Molecular Formula | C10H9F3O4 |
| Molecular Weight | 250.17 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | methyl 2,3-dihydroxy-3-(2,3,6-trifluorophenyl)propanoate |
| SMILES | COC(=O)C(O)C(O)c1c(F)ccc(F)c1F |
| InChI | InChI=1S/C10H9F3O4/c1-17-10(16)9(15)8(14)6-4(11)2-3-5(12)7(6)13/h2-3,8-9,14-15H,1H3 |
| InChIKey | GYEQTLYRNJOWTP-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.17 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|