C11H13F2NO4 — CID 171866170
ethyl 3-(3-amino-2,6-difluorophenyl)-2,3-dihydroxypropanoate (PubChem CID 171866170) has the molecular formula C11H13F2NO4 and a molecular weight of 261.22 g/mol. Its IUPAC name is ethyl 3-(3-amino-2,6-difluorophenyl)-2,3-dihydroxypropanoate.
| Compound Name | ethyl 3-(3-amino-2,6-difluorophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171866170 |
| Molecular Formula | C11H13F2NO4 |
| Molecular Weight | 261.22 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | ethyl 3-(3-amino-2,6-difluorophenyl)-2,3-dihydroxypropanoate |
| SMILES | CCOC(=O)C(O)C(O)c1c(F)ccc(N)c1F |
| InChI | InChI=1S/C11H13F2NO4/c1-2-18-11(17)10(16)9(15)7-5(12)3-4-6(14)8(7)13/h3-4,9-10,15-16H,2,14H2,1H3 |
| InChIKey | WGVMNYACYYEKEX-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|