C9H11F2NO3 — CID 170817924
1-(3-amino-2,6-difluorophenyl)propane-1,2,3-triol (PubChem CID 170817924) has the molecular formula C9H11F2NO3 and a molecular weight of 219.19 g/mol. Its IUPAC name is 1-(3-amino-2,6-difluorophenyl)propane-1,2,3-triol.
| Compound Name | 1-(3-amino-2,6-difluorophenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170817924 |
| Molecular Formula | C9H11F2NO3 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 1-(3-amino-2,6-difluorophenyl)propane-1,2,3-triol |
| SMILES | Nc1ccc(F)c(C(O)C(O)CO)c1F |
| InChI | InChI=1S/C9H11F2NO3/c10-4-1-2-5(12)8(11)7(4)9(15)6(14)3-13/h1-2,6,9,13-15H,3,12H2 |
| InChIKey | MOJCSSYUZHEKNG-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|