C10H12F2O3 — CID 170819048
1-(2,6-difluoro-3-methylphenyl)propane-1,2,3-triol (PubChem CID 170819048) has the molecular formula C10H12F2O3 and a molecular weight of 218.20 g/mol. Its IUPAC name is 1-(2,6-difluoro-3-methylphenyl)propane-1,2,3-triol.
| Compound Name | 1-(2,6-difluoro-3-methylphenyl)propane-1,2,3-triol |
|---|---|
| PubChem CID | 170819048 |
| Molecular Formula | C10H12F2O3 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 1-(2,6-difluoro-3-methylphenyl)propane-1,2,3-triol |
| SMILES | Cc1ccc(F)c(C(O)C(O)CO)c1F |
| InChI | InChI=1S/C10H12F2O3/c1-5-2-3-6(11)8(9(5)12)10(15)7(14)4-13/h2-3,7,10,13-15H,4H2,1H3 |
| InChIKey | IQYDZERWNWWHFB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |